C17H14 — CID 154715457
(1R,2S,13R,14R)-pentacyclo[12.2.1.02,13.03,12.04,9]heptadeca-3(12),4,6,8,10,15-hexaene (PubChem CID 154715457) has the molecular formula C17H14 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1R,2S,13R,14R)-pentacyclo[12.2.1.02,13.03,12.04,9]heptadeca-3(12),4,6,8,10,15-hexaene.
| Compound Name | (1R,2S,13R,14R)-pentacyclo[12.2.1.02,13.03,12.04,9]heptadeca-3(12),4,6,8,10,15-hexaene |
|---|---|
| PubChem CID | 154715457 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1R,2S,13R,14R)-pentacyclo[12.2.1.02,13.03,12.04,9]heptadeca-3(12),4,6,8,10,15-hexaene |
| SMILES | C1=C[C@H]2C[C@H]1[C@@H]1c3c(ccc4ccccc34)[C@@H]12 |
| InChI | InChI=1S/C17H14/c1-2-4-13-10(3-1)7-8-14-15-11-5-6-12(9-11)16(15)17(13)14/h1-8,11-12,15-16H,9H2/t11-,12-,15-,16-/m0/s1 |
| InChIKey | ZXRYIJLAPDZKOQ-APYUEPQZSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|