C10H7F6NO — CID 15471547
1,1,1,3,3,3-hexafluoro-N-(4-methoxyphenyl)propan-2-imine (PubChem CID 15471547) has the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N-(4-methoxyphenyl)propan-2-imine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N-(4-methoxyphenyl)propan-2-imine |
|---|---|
| PubChem CID | 15471547 |
| Molecular Formula | C10H7F6NO |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N-(4-methoxyphenyl)propan-2-imine |
| SMILES | COc1ccc(N=C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F6NO/c1-18-7-4-2-6(3-5-7)17-8(9(11,12)13)10(14,15)16/h2-5H,1H3 |
| InChIKey | FRNUJUDPEZOYJD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|