C22H24FNO4S — CID 154715470
methyl 3-fluoro-6-[1-(4-methylphenyl)sulfonylindol-3-yl]hexanoate (PubChem CID 154715470) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is methyl 3-fluoro-6-[1-(4-methylphenyl)sulfonylindol-3-yl]hexanoate.
| Compound Name | methyl 3-fluoro-6-[1-(4-methylphenyl)sulfonylindol-3-yl]hexanoate |
|---|---|
| PubChem CID | 154715470 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | methyl 3-fluoro-6-[1-(4-methylphenyl)sulfonylindol-3-yl]hexanoate |
| SMILES | COC(=O)CC(F)CCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C22H24FNO4S/c1-16-10-12-19(13-11-16)29(26,27)24-15-17(20-8-3-4-9-21(20)24)6-5-7-18(23)14-22(25)28-2/h3-4,8-13,15,18H,5-7,14H2,1-2H3 |
| InChIKey | YACGVHGEOROWHJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |