About (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine
(4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine (PubChem CID 154715474) has the molecular formula C19H20FNO
and a molecular weight of 297.37 g/mol. Its IUPAC name is (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine.
Molecular Properties
| Compound Name | (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine |
| PubChem CID | 154715474 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine |
| SMILES | CC(C)(C)[C@]1(F)Cc2ccccc2N=C(c2ccccc2)O1 |
| InChI | InChI=1S/C19H20FNO/c1-18(2,3)19(20)13-15-11-7-8-12-16(15)21-17(22-19)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3/t19-/m0/s1 |
| InChIKey | ASRKCAUZTGHFOK-IBGZPJMESA-N |
| XLogP | 5.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine?
The IUPAC name of (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine (CID 154715474) is (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine.
What is the SMILES notation for (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine?
The canonical SMILES for (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine is CC(C)(C)[C@]1(F)Cc2ccccc2N=C(c2ccccc2)O1.
What is the InChIKey of (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine?
The InChIKey is ASRKCAUZTGHFOK-IBGZPJMESA-N. The full InChI is InChI=1S/C19H20FNO/c1-18(2,3)19(20)13-15-11-7-8-12-16(15)21-17(22-19)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3/t19-/m0/s1.
What are the key properties of (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine?
(4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine has a molecular weight of 297.37 g/mol, XLogP of 5.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-tert-butyl-4-fluoro-2-phenyl-5H-3,1-benzoxazepine is sourced from PubChem (CID 154715474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).