C19H18F3NO2 — CID 154715512
ethyl 2-[(R)-phenyl-[4-(trifluoromethyl)anilino]methyl]prop-2-enoate (PubChem CID 154715512) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is ethyl 2-[(R)-phenyl-[4-(trifluoromethyl)anilino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(R)-phenyl-[4-(trifluoromethyl)anilino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 154715512 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 2-[(R)-phenyl-[4-(trifluoromethyl)anilino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@H](Nc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H18F3NO2/c1-3-25-18(24)13(2)17(14-7-5-4-6-8-14)23-16-11-9-15(10-12-16)19(20,21)22/h4-12,17,23H,2-3H2,1H3/t17-/m0/s1 |
| InChIKey | ALYODIBGNVKWJD-KRWDZBQOSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|