C25H23NO5S — CID 154715598
N-benzyl-N-(5-methoxy-3-methyl-4-oxochromen-2-yl)-4-methylbenzenesulfonamide (PubChem CID 154715598) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-benzyl-N-(5-methoxy-3-methyl-4-oxochromen-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-(5-methoxy-3-methyl-4-oxochromen-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154715598 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-benzyl-N-(5-methoxy-3-methyl-4-oxochromen-2-yl)-4-methylbenzenesulfonamide |
| SMILES | COc1cccc2oc(N(Cc3ccccc3)S(=O)(=O)c3ccc(C)cc3)c(C)c(=O)c12 |
| InChI | InChI=1S/C25H23NO5S/c1-17-12-14-20(15-13-17)32(28,29)26(16-19-8-5-4-6-9-19)25-18(2)24(27)23-21(30-3)10-7-11-22(23)31-25/h4-15H,16H2,1-3H3 |
| InChIKey | GHWMSLPVVSIRMU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |