C20H15N3O3S — CID 15471561
(3E)-3-[(2-anilino-4-hydroxy-1,3-thiazol-5-yl)methylidene]-8-methyl-1H-quinoline-2,4-dione (PubChem CID 15471561) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is (3E)-3-[(2-anilino-4-hydroxy-1,3-thiazol-5-yl)methylidene]-8-methyl-1H-quinoline-2,4-dione.
| Compound Name | (3E)-3-[(2-anilino-4-hydroxy-1,3-thiazol-5-yl)methylidene]-8-methyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 15471561 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (3E)-3-[(2-anilino-4-hydroxy-1,3-thiazol-5-yl)methylidene]-8-methyl-1H-quinoline-2,4-dione |
| SMILES | Cc1cccc2c1NC(=O)/C(=C/c1sc(Nc3ccccc3)nc1O)C2=O |
| InChI | InChI=1S/C20H15N3O3S/c1-11-6-5-9-13-16(11)22-18(25)14(17(13)24)10-15-19(26)23-20(27-15)21-12-7-3-2-4-8-12/h2-10,26H,1H3,(H,21,23)(H,22,25)/b14-10+ |
| InChIKey | WYYDHGHDSMOLOH-GXDHUFHOSA-N |
| XLogP | 4.12 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|