About dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate
dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate (PubChem CID 154715909) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate |
| PubChem CID | 154715909 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(CCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c1-23-15(20)13-14(16(21)24-2)19(11-12-7-4-3-5-8-12)17(22)18(13)9-6-10-18/h3-5,7-8H,6,9-11H2,1-2H3 |
| InChIKey | YVFXLQNGKXRNJL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate?
The IUPAC name of dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate (CID 154715909) is dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate.
What is the SMILES notation for dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate?
The canonical SMILES for dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate is COC(=O)C1=C(C(=O)OC)C2(CCC2)C(=O)N1Cc1ccccc1.
What is the InChIKey of dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate?
The InChIKey is YVFXLQNGKXRNJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-23-15(20)13-14(16(21)24-2)19(11-12-7-4-3-5-8-12)17(22)18(13)9-6-10-18/h3-5,7-8H,6,9-11H2,1-2H3.
What are the key properties of dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate?
dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate has a molecular weight of 329.35 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 6-benzyl-5-oxo-6-azaspiro[3.4]oct-7-ene-7,8-dicarboxylate is sourced from PubChem (CID 154715909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).