C19H21NO7 — CID 154715911
4-O-ethyl 2-O,3-O-dimethyl 1-benzyl-4-methyl-5-oxopyrrole-2,3,4-tricarboxylate (PubChem CID 154715911) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-O-ethyl 2-O,3-O-dimethyl 1-benzyl-4-methyl-5-oxopyrrole-2,3,4-tricarboxylate.
| Compound Name | 4-O-ethyl 2-O,3-O-dimethyl 1-benzyl-4-methyl-5-oxopyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 154715911 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-O-ethyl 2-O,3-O-dimethyl 1-benzyl-4-methyl-5-oxopyrrole-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C)C(=O)N(Cc2ccccc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C19H21NO7/c1-5-27-18(24)19(2)13(15(21)25-3)14(16(22)26-4)20(17(19)23)11-12-9-7-6-8-10-12/h6-10H,5,11H2,1-4H3 |
| InChIKey | XSQNMDAXLAOTHT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|