C20H18N4 — CID 154715961
5,6,15,16-tetramethyl-2,7,12,17-tetrazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),5,9,11,14(18),15,19-nonaene (PubChem CID 154715961) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5,6,15,16-tetramethyl-2,7,12,17-tetrazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),5,9,11,14(18),15,19-nonaene.
| Compound Name | 5,6,15,16-tetramethyl-2,7,12,17-tetrazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),5,9,11,14(18),15,19-nonaene |
|---|---|
| PubChem CID | 154715961 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 5,6,15,16-tetramethyl-2,7,12,17-tetrazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),5,9,11,14(18),15,19-nonaene |
| SMILES | Cc1[nH]c2ccc3nc4c(ccc5[nH]c(C)c(C)c54)nc3c2c1C |
| InChI | InChI=1S/C20H18N4/c1-9-11(3)21-13-5-7-15-19(17(9)13)23-16-8-6-14-18(20(16)24-15)10(2)12(4)22-14/h5-8,21-22H,1-4H3 |
| InChIKey | WZLURZYFJKPFTA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|