About (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride
(E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride (PubChem CID 154716019) has the molecular formula C7H4Cl2FNO2S
and a molecular weight of 256.09 g/mol. Its IUPAC name is (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride.
Molecular Properties
| Compound Name | (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride |
| PubChem CID | 154716019 |
| Molecular Formula | C7H4Cl2FNO2S |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride |
| SMILES | O=S(=O)(F)/C=C/c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2FNO2S/c8-6-3-5(4-7(9)11-6)1-2-14(10,12)13/h1-4H/b2-1+ |
| InChIKey | XTZMAKHZJHYSPC-OWOJBTEDSA-N |
| XLogP | 2.66 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride?
The IUPAC name of (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride (CID 154716019) is (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride.
What is the SMILES notation for (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride?
The canonical SMILES for (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride is O=S(=O)(F)/C=C/c1cc(Cl)nc(Cl)c1.
What is the InChIKey of (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride?
The InChIKey is XTZMAKHZJHYSPC-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H4Cl2FNO2S/c8-6-3-5(4-7(9)11-6)1-2-14(10,12)13/h1-4H/b2-1+.
What are the key properties of (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride?
(E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride has a molecular weight of 256.09 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2,6-dichloro-4-pyridinyl)ethenesulfonyl fluoride is sourced from PubChem (CID 154716019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).