C28H29FN2O3Si — CID 154716097
(4R,6S)-6-[[benzhydryl(dimethyl)silyl]methyl]-5'-fluoro-1'-methylspiro[1,3-oxazinane-4,3'-indole]-2,2'-dione (PubChem CID 154716097) has the molecular formula C28H29FN2O3Si and a molecular weight of 488.64 g/mol. Its IUPAC name is (4R,6S)-6-[[benzhydryl(dimethyl)silyl]methyl]-5'-fluoro-1'-methylspiro[1,3-oxazinane-4,3'-indole]-2,2'-dione.
| Compound Name | (4R,6S)-6-[[benzhydryl(dimethyl)silyl]methyl]-5'-fluoro-1'-methylspiro[1,3-oxazinane-4,3'-indole]-2,2'-dione |
|---|---|
| PubChem CID | 154716097 |
| Molecular Formula | C28H29FN2O3Si |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (4R,6S)-6-[[benzhydryl(dimethyl)silyl]methyl]-5'-fluoro-1'-methylspiro[1,3-oxazinane-4,3'-indole]-2,2'-dione |
| SMILES | CN1C(=O)[C@@]2(C[C@@H](C[Si](C)(C)C(c3ccccc3)c3ccccc3)OC(=O)N2)c2cc(F)ccc21 |
| InChI | InChI=1S/C28H29FN2O3Si/c1-31-24-15-14-21(29)16-23(24)28(26(31)32)17-22(34-27(33)30-28)18-35(2,3)25(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-16,22,25H,17-18H2,1-3H3,(H,30,33)/t22-,28+/m0/s1 |
| InChIKey | MBGKAJYEOMPIKR-RBISFHTESA-N |
| XLogP | 5.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|