C12H24O2Si — CID 154716210
cis-(1S,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropane-1-carbaldehyde (PubChem CID 154716210) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is cis-(1S,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 154716210 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cis-(1S,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1C[C@@H]1C=O |
| InChI | InChI=1S/C12H24O2Si/c1-12(2,3)15(4,5)14-7-6-10-8-11(10)9-13/h9-11H,6-8H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | NOOWXHOKVIQAFQ-GHMZBOCLSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|