C32H66B2GeSi4 — CID 154716234
[2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane (PubChem CID 154716234) has the molecular formula C32H66B2GeSi4 and a molecular weight of 657.46 g/mol. Its IUPAC name is [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane.
| Compound Name | [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 154716234 |
| Molecular Formula | C32H66B2GeSi4 |
| Molecular Weight | 657.46 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | [2,7-bis(diethylboranyl)-3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C)[Ge]2(C([Si](C)(C)C)=C1CC)C([Si](C)(C)C)=C(CC)C(B(CC)CC)=C2[Si](C)(C)C |
| InChI | InChI=1S/C32H66B2GeSi4/c1-19-25-27(33(21-3)22-4)31(38(13,14)15)35(29(25)36(7,8)9)30(37(10,11)12)26(20-2)28(34(23-5)24-6)32(35)39(16,17)18/h19-24H2,1-18H3 |
| InChIKey | USBABUKAMKDSLW-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.46 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|