C24H22FNO — CID 154716327
(2R,3S)-3-(3,5-dimethylphenyl)-2-fluoro-1-phenyl-2-pyridin-2-ylpent-4-en-1-one (PubChem CID 154716327) has the molecular formula C24H22FNO and a molecular weight of 359.44 g/mol. Its IUPAC name is (2R,3S)-3-(3,5-dimethylphenyl)-2-fluoro-1-phenyl-2-pyridin-2-ylpent-4-en-1-one.
| Compound Name | (2R,3S)-3-(3,5-dimethylphenyl)-2-fluoro-1-phenyl-2-pyridin-2-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 154716327 |
| Molecular Formula | C24H22FNO |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2R,3S)-3-(3,5-dimethylphenyl)-2-fluoro-1-phenyl-2-pyridin-2-ylpent-4-en-1-one |
| SMILES | C=C[C@@H](c1cc(C)cc(C)c1)[C@](F)(C(=O)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C24H22FNO/c1-4-21(20-15-17(2)14-18(3)16-20)24(25,22-12-8-9-13-26-22)23(27)19-10-6-5-7-11-19/h4-16,21H,1H2,2-3H3/t21-,24+/m0/s1 |
| InChIKey | ALVPWDNCTKNRKX-XUZZJYLKSA-N |
| XLogP | 5.72 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|