C20H16FNO2 — CID 154716329
(2R,3S)-2-fluoro-3-(furan-2-yl)-1-phenyl-2-pyridin-2-ylpent-4-en-1-one (PubChem CID 154716329) has the molecular formula C20H16FNO2 and a molecular weight of 321.35 g/mol. Its IUPAC name is (2R,3S)-2-fluoro-3-(furan-2-yl)-1-phenyl-2-pyridin-2-ylpent-4-en-1-one.
| Compound Name | (2R,3S)-2-fluoro-3-(furan-2-yl)-1-phenyl-2-pyridin-2-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 154716329 |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2R,3S)-2-fluoro-3-(furan-2-yl)-1-phenyl-2-pyridin-2-ylpent-4-en-1-one |
| SMILES | C=C[C@@H](c1ccco1)[C@](F)(C(=O)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C20H16FNO2/c1-2-16(17-11-8-14-24-17)20(21,18-12-6-7-13-22-18)19(23)15-9-4-3-5-10-15/h2-14,16H,1H2/t16-,20+/m0/s1 |
| InChIKey | PCXOBDGKNLYCFX-OXJNMPFZSA-N |
| XLogP | 4.69 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|