C26H23ClN6O3S — CID 154716332
4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxybenzamide (PubChem CID 154716332) has the molecular formula C26H23ClN6O3S and a molecular weight of 535.03 g/mol. Its IUPAC name is 4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 154716332 |
| Molecular Formula | C26H23ClN6O3S |
| Molecular Weight | 535.03 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxybenzamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1ccc(C(=O)NO)cc1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C26H23ClN6O3S/c1-13-14(2)37-26-22(13)23(16-4-8-18(27)9-5-16)29-20(24-31-30-15(3)33(24)26)12-21(34)28-19-10-6-17(7-11-19)25(35)32-36/h4-11,20,36H,12H2,1-3H3,(H,28,34)(H,32,35)/t20-/m0/s1 |
| InChIKey | JBPWXWQIGDWQHR-FQEVSTJZSA-N |
| XLogP | 4.95 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|