C24H20O2 — CID 154716504
(1S,8R,12S)-1-methyl-5,7-diphenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one (PubChem CID 154716504) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1S,8R,12S)-1-methyl-5,7-diphenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one.
| Compound Name | (1S,8R,12S)-1-methyl-5,7-diphenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
|---|---|
| PubChem CID | 154716504 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (1S,8R,12S)-1-methyl-5,7-diphenyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
| SMILES | C[C@@]12C=CC(=O)[C@H]3C(c4ccccc4)=CC(c4ccccc4)=C(CO1)[C@H]32 |
| InChI | InChI=1S/C24H20O2/c1-24-13-12-21(25)22-19(17-10-6-3-7-11-17)14-18(16-8-4-2-5-9-16)20(15-26-24)23(22)24/h2-14,22-23H,15H2,1H3/t22-,23-,24+/m1/s1 |
| InChIKey | GHIBPKXBVRMELU-SMIHKQSGSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |