About 1,3,8-trichlorophenazine
1,3,8-trichlorophenazine (PubChem CID 154716543) has the molecular formula C12H5Cl3N2
and a molecular weight of 283.55 g/mol. Its IUPAC name is 1,3,8-trichlorophenazine.
Molecular Properties
| Compound Name | 1,3,8-trichlorophenazine |
| PubChem CID | 154716543 |
| Molecular Formula | C12H5Cl3N2 |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1,3,8-trichlorophenazine |
| SMILES | Clc1ccc2nc3cc(Cl)cc(Cl)c3nc2c1 |
| InChI | InChI=1S/C12H5Cl3N2/c13-6-1-2-9-10(4-6)17-12-8(15)3-7(14)5-11(12)16-9/h1-5H |
| InChIKey | PSWNSXGINXAFJK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3,8-trichlorophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,8-trichlorophenazine?
The IUPAC name of 1,3,8-trichlorophenazine (CID 154716543) is 1,3,8-trichlorophenazine.
What is the SMILES notation for 1,3,8-trichlorophenazine?
The canonical SMILES for 1,3,8-trichlorophenazine is Clc1ccc2nc3cc(Cl)cc(Cl)c3nc2c1.
What is the InChIKey of 1,3,8-trichlorophenazine?
The InChIKey is PSWNSXGINXAFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl3N2/c13-6-1-2-9-10(4-6)17-12-8(15)3-7(14)5-11(12)16-9/h1-5H.
What are the key properties of 1,3,8-trichlorophenazine?
1,3,8-trichlorophenazine has a molecular weight of 283.55 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,8-trichlorophenazine is sourced from PubChem (CID 154716543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).