C20H27F2N6O4P — CID 154716599
8-(2,4-difluorophenyl)-9-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethyl]purine-2,6-diamine (PubChem CID 154716599) has the molecular formula C20H27F2N6O4P and a molecular weight of 484.44 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-9-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethyl]purine-2,6-diamine.
| Compound Name | 8-(2,4-difluorophenyl)-9-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 154716599 |
| Molecular Formula | C20H27F2N6O4P |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 8-(2,4-difluorophenyl)-9-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethyl]purine-2,6-diamine |
| SMILES | CC(C)OP(=O)(COCCn1c(-c2ccc(F)cc2F)nc2c(N)nc(N)nc21)OC(C)C |
| InChI | InChI=1S/C20H27F2N6O4P/c1-11(2)31-33(29,32-12(3)4)10-30-8-7-28-18(14-6-5-13(21)9-15(14)22)25-16-17(23)26-20(24)27-19(16)28/h5-6,9,11-12H,7-8,10H2,1-4H3,(H4,23,24,26,27) |
| InChIKey | AQGPKTGYNUUMNW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|