About 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole
5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole (PubChem CID 154716836) has the molecular formula C25H24N2O2S
and a molecular weight of 416.55 g/mol. Its IUPAC name is 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
| PubChem CID | 154716836 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole |
| SMILES | C=C(c1ccccc1C)C1CN=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-18-13-15-22(16-14-18)30(28,29)27-24(20(3)23-12-8-7-9-19(23)2)17-26-25(27)21-10-5-4-6-11-21/h4-16,24H,3,17H2,1-2H3 |
| InChIKey | QCTMQSWFJUHVBU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole?
The IUPAC name of 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole (CID 154716836) is 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole.
What is the SMILES notation for 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole?
The canonical SMILES for 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole is C=C(c1ccccc1C)C1CN=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole?
The InChIKey is QCTMQSWFJUHVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O2S/c1-18-13-15-22(16-14-18)30(28,29)27-24(20(3)23-12-8-7-9-19(23)2)17-26-25(27)21-10-5-4-6-11-21/h4-16,24H,3,17H2,1-2H3.
What are the key properties of 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole?
5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole has a molecular weight of 416.55 g/mol, XLogP of 4.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2-methylphenyl)ethenyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4,5-dihydroimidazole is sourced from PubChem (CID 154716836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).