C24H31F3O2 — CID 154717043
(13S)-13-methyl-3-(6,6,6-trifluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 154717043) has the molecular formula C24H31F3O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (13S)-13-methyl-3-(6,6,6-trifluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S)-13-methyl-3-(6,6,6-trifluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154717043 |
| Molecular Formula | C24H31F3O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (13S)-13-methyl-3-(6,6,6-trifluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3c4ccc(OCCCCCC(F)(F)F)cc4CCC3C1CCC2=O |
| InChI | InChI=1S/C24H31F3O2/c1-23-13-11-19-18-8-6-17(29-14-4-2-3-12-24(25,26)27)15-16(18)5-7-20(19)21(23)9-10-22(23)28/h6,8,15,19-21H,2-5,7,9-14H2,1H3/t19?,20?,21?,23-/m0/s1 |
| InChIKey | RZUDFLKEWQCLDS-FTKYIGPGSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|