C13H16FNO3 — CID 154717243
(4S,6S)-4-fluoro-2,2-dimethyl-6-(4-nitrophenyl)oxane (PubChem CID 154717243) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is (4S,6S)-4-fluoro-2,2-dimethyl-6-(4-nitrophenyl)oxane.
| Compound Name | (4S,6S)-4-fluoro-2,2-dimethyl-6-(4-nitrophenyl)oxane |
|---|---|
| PubChem CID | 154717243 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (4S,6S)-4-fluoro-2,2-dimethyl-6-(4-nitrophenyl)oxane |
| SMILES | CC1(C)C[C@@H](F)C[C@@H](c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C13H16FNO3/c1-13(2)8-10(14)7-12(18-13)9-3-5-11(6-4-9)15(16)17/h3-6,10,12H,7-8H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | OOADOGNAEZWOFR-JQWIXIFHSA-N |
| XLogP | 3.56 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|