C42H39N3O4 — CID 154717251
9-ethyl-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine (PubChem CID 154717251) has the molecular formula C42H39N3O4 and a molecular weight of 649.79 g/mol. Its IUPAC name is 9-ethyl-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine.
| Compound Name | 9-ethyl-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine |
|---|---|
| PubChem CID | 154717251 |
| Molecular Formula | C42H39N3O4 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 9-ethyl-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine |
| SMILES | CCn1c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2c2cc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C42H39N3O4/c1-6-43-41-25-15-33(44(29-7-17-35(46-2)18-8-29)30-9-19-36(47-3)20-10-30)27-39(41)40-28-34(16-26-42(40)43)45(31-11-21-37(48-4)22-12-31)32-13-23-38(49-5)24-14-32/h7-28H,6H2,1-5H3 |
| InChIKey | CCRDPNNSFMJDCW-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |