C17H35NO2Si — CID 154717346
trimethyl-[(1S)-3,3,5-trimethyl-1-(morpholin-4-ylmethyl)cyclohexyl]oxysilane (PubChem CID 154717346) has the molecular formula C17H35NO2Si and a molecular weight of 313.56 g/mol. Its IUPAC name is trimethyl-[(1S)-3,3,5-trimethyl-1-(morpholin-4-ylmethyl)cyclohexyl]oxysilane.
| Compound Name | trimethyl-[(1S)-3,3,5-trimethyl-1-(morpholin-4-ylmethyl)cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 154717346 |
| Molecular Formula | C17H35NO2Si |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | trimethyl-[(1S)-3,3,5-trimethyl-1-(morpholin-4-ylmethyl)cyclohexyl]oxysilane |
| SMILES | CC1CC(C)(C)C[C@@](CN2CCOCC2)(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H35NO2Si/c1-15-11-16(2,3)13-17(12-15,20-21(4,5)6)14-18-7-9-19-10-8-18/h15H,7-14H2,1-6H3/t15?,17-/m0/s1 |
| InChIKey | QPRAQCIEZKAGMB-LWKPJOBUSA-N |
| XLogP | 3.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|