About N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide
N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide (PubChem CID 154717547) has the molecular formula C22H34FNOSi
and a molecular weight of 375.60 g/mol. Its IUPAC name is N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide |
| PubChem CID | 154717547 |
| Molecular Formula | C22H34FNOSi |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H34FNOSi/c1-15(2)26(16(3)4,17(5)6)14-13-22(24-19(8)25)18(7)20-9-11-21(23)12-10-20/h9-12,15-18,22H,1-8H3,(H,24,25)/t18-,22-/m0/s1 |
| InChIKey | HWPXHNPMIKJDCI-AVRDEDQJSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide?
The IUPAC name of N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide (CID 154717547) is N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide.
What is the SMILES notation for N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide?
The canonical SMILES for N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide is CC(=O)N[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)c1ccc(F)cc1.
What is the InChIKey of N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide?
The InChIKey is HWPXHNPMIKJDCI-AVRDEDQJSA-N. The full InChI is InChI=1S/C22H34FNOSi/c1-15(2)26(16(3)4,17(5)6)14-13-22(24-19(8)25)18(7)20-9-11-21(23)12-10-20/h9-12,15-18,22H,1-8H3,(H,24,25)/t18-,22-/m0/s1.
What are the key properties of N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide?
N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide has a molecular weight of 375.60 g/mol, XLogP of 5.66, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-4-(4-fluorophenyl)-1-tri(propan-2-yl)silylpent-1-yn-3-yl]acetamide is sourced from PubChem (CID 154717547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).