About 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine
6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 154717655) has the molecular formula C12H14FN
and a molecular weight of 191.25 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine |
| PubChem CID | 154717655 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC1CCCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C12H14FN/c1-9-3-2-4-12(14-9)10-5-7-11(13)8-6-10/h5-9H,2-4H2,1H3 |
| InChIKey | ZYEJDPCFEDUGSH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine (CID 154717655) is 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine is CC1CCCC(c2ccc(F)cc2)=N1.
What is the InChIKey of 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine?
The InChIKey is ZYEJDPCFEDUGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN/c1-9-3-2-4-12(14-9)10-5-7-11(13)8-6-10/h5-9H,2-4H2,1H3.
What are the key properties of 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine?
6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine has a molecular weight of 191.25 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-2-methyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 154717655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).