C22H27NO — CID 154717668
(2S,4S)-2-cyclohexyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-8-ol (PubChem CID 154717668) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (2S,4S)-2-cyclohexyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-8-ol.
| Compound Name | (2S,4S)-2-cyclohexyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-8-ol |
|---|---|
| PubChem CID | 154717668 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2S,4S)-2-cyclohexyl-4-methyl-4-phenyl-2,3-dihydro-1H-quinolin-8-ol |
| SMILES | C[C@@]1(c2ccccc2)C[C@@H](C2CCCCC2)Nc2c(O)cccc21 |
| InChI | InChI=1S/C22H27NO/c1-22(17-11-6-3-7-12-17)15-19(16-9-4-2-5-10-16)23-21-18(22)13-8-14-20(21)24/h3,6-8,11-14,16,19,23-24H,2,4-5,9-10,15H2,1H3/t19-,22-/m0/s1 |
| InChIKey | VWHQQMRGDKXKHR-UGKGYDQZSA-N |
| XLogP | 5.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|