C12H16O5 — CID 154717949
dimethyl (3S)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate (PubChem CID 154717949) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is dimethyl (3S)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3S)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 154717949 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | dimethyl (3S)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)CC1C=O |
| InChI | InChI=1S/C12H16O5/c1-4-8-5-12(10(14)16-2,11(15)17-3)6-9(8)7-13/h4,7-9H,1,5-6H2,2-3H3/t8-,9?/m1/s1 |
| InChIKey | OSEYWOXDWYANGC-VEDVMXKPSA-N |
| XLogP | 0.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|