C27H22F5N2O+ — CID 154718034
6,18-diethyl-12-(2,3,4,5,6-pentafluorophenyl)-2-oxa-18-aza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene (PubChem CID 154718034) has the molecular formula C27H22F5N2O+ and a molecular weight of 485.48 g/mol. Its IUPAC name is 6,18-diethyl-12-(2,3,4,5,6-pentafluorophenyl)-2-oxa-18-aza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene.
| Compound Name | 6,18-diethyl-12-(2,3,4,5,6-pentafluorophenyl)-2-oxa-18-aza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene |
|---|---|
| PubChem CID | 154718034 |
| Molecular Formula | C27H22F5N2O+ |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 6,18-diethyl-12-(2,3,4,5,6-pentafluorophenyl)-2-oxa-18-aza-6-azoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene |
| SMILES | CCN1CCc2cc3c(cc21)Oc1cc2c(cc1=C3c1c(F)c(F)c(F)c(F)c1F)CC[N+]=2CC |
| InChI | InChI=1S/C27H22F5N2O/c1-3-33-7-5-13-9-15-19(11-17(13)33)35-20-12-18-14(6-8-34(18)4-2)10-16(20)21(15)22-23(28)25(30)27(32)26(31)24(22)29/h9-12H,3-8H2,1-2H3/q+1 |
| InChIKey | HBZHRIYOQDMQKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|