C21H22FNO3 — CID 154718197
methyl (E,2R,3S)-2-benzamido-5-(2-fluorophenyl)-2,3-dimethylpent-4-enoate (PubChem CID 154718197) has the molecular formula C21H22FNO3 and a molecular weight of 355.41 g/mol. Its IUPAC name is methyl (E,2R,3S)-2-benzamido-5-(2-fluorophenyl)-2,3-dimethylpent-4-enoate.
| Compound Name | methyl (E,2R,3S)-2-benzamido-5-(2-fluorophenyl)-2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 154718197 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl (E,2R,3S)-2-benzamido-5-(2-fluorophenyl)-2,3-dimethylpent-4-enoate |
| SMILES | COC(=O)[C@](C)(NC(=O)c1ccccc1)[C@@H](C)/C=C/c1ccccc1F |
| InChI | InChI=1S/C21H22FNO3/c1-15(13-14-16-9-7-8-12-18(16)22)21(2,20(25)26-3)23-19(24)17-10-5-4-6-11-17/h4-15H,1-3H3,(H,23,24)/b14-13+/t15-,21+/m0/s1 |
| InChIKey | MTNORPBVSROOER-LAZGGGQISA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |