C22H29BO5 — CID 154718471
(3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 154718471) has the molecular formula C22H29BO5 and a molecular weight of 384.28 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 154718471 |
| Molecular Formula | C22H29BO5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | CC1(C)OB([C@@H]2C[C@]3(C)C(=O)CC[C@]3(O)[C@H]2C(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H29BO5/c1-19(2)20(3,4)28-23(27-19)15-13-21(5)16(24)11-12-22(21,26)17(15)18(25)14-9-7-6-8-10-14/h6-10,15,17,26H,11-13H2,1-5H3/t15-,17-,21-,22+/m1/s1 |
| InChIKey | QDQWETMUBSETCP-VIDZHXABSA-N |
| XLogP | 3.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|