C11H26O3Si — CID 154718482
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxypentane-2,3-diol (PubChem CID 154718482) has the molecular formula C11H26O3Si and a molecular weight of 234.41 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxypentane-2,3-diol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxypentane-2,3-diol |
|---|---|
| PubChem CID | 154718482 |
| Molecular Formula | C11H26O3Si |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxypentane-2,3-diol |
| SMILES | CC[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H26O3Si/c1-7-9(12)10(13)8-14-15(5,6)11(2,3)4/h9-10,12-13H,7-8H2,1-6H3/t9-,10-/m1/s1 |
| InChIKey | NPIABEFNIJPLLA-NXEZZACHSA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|