C35H43NO5S2 — CID 154718517
(1S,2S,3S,5R,6R,8R)-6-(methoxymethoxy)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-1,3-dithiane] (PubChem CID 154718517) has the molecular formula C35H43NO5S2 and a molecular weight of 621.87 g/mol. Its IUPAC name is (1S,2S,3S,5R,6R,8R)-6-(methoxymethoxy)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-1,3-dithiane].
| Compound Name | (1S,2S,3S,5R,6R,8R)-6-(methoxymethoxy)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-1,3-dithiane] |
|---|---|
| PubChem CID | 154718517 |
| Molecular Formula | C35H43NO5S2 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | (1S,2S,3S,5R,6R,8R)-6-(methoxymethoxy)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-1,3-dithiane] |
| SMILES | COCO[C@@H]1[C@@H](C)N2[C@@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2C12SCCCS2 |
| InChI | InChI=1S/C35H43NO5S2/c1-26-34(41-25-37-2)35(42-19-12-20-43-35)33-32(40-23-29-17-10-5-11-18-29)31(39-22-28-15-8-4-9-16-28)30(36(26)33)24-38-21-27-13-6-3-7-14-27/h3-11,13-18,26,30-34H,12,19-25H2,1-2H3/t26-,30+,31+,32-,33-,34-/m1/s1 |
| InChIKey | ZABGZFAAUAFNRE-PTXILSDTSA-N |
| XLogP | 6.38 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|