C26H32BNO2 — CID 154718668
1-methyl-5-[(E)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-yl]indole (PubChem CID 154718668) has the molecular formula C26H32BNO2 and a molecular weight of 401.36 g/mol. Its IUPAC name is 1-methyl-5-[(E)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-yl]indole.
| Compound Name | 1-methyl-5-[(E)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-yl]indole |
|---|---|
| PubChem CID | 154718668 |
| Molecular Formula | C26H32BNO2 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 1-methyl-5-[(E)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-2-en-2-yl]indole |
| SMILES | C/C(=C\C(CB1OC(C)(C)C(C)(C)O1)c1ccccc1)c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C26H32BNO2/c1-19(21-12-13-24-22(17-21)14-15-28(24)6)16-23(20-10-8-7-9-11-20)18-27-29-25(2,3)26(4,5)30-27/h7-17,23H,18H2,1-6H3/b19-16+ |
| InChIKey | XKGVYSSWRHGBSE-KNTRCKAVSA-N |
| XLogP | 6.46 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|