C19H25NO4 — CID 154718881
tert-butyl (1R,2R,10bS)-2-hydroxy-1-prop-2-enyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate (PubChem CID 154718881) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl (1R,2R,10bS)-2-hydroxy-1-prop-2-enyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1R,2R,10bS)-2-hydroxy-1-prop-2-enyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 154718881 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butyl (1R,2R,10bS)-2-hydroxy-1-prop-2-enyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate |
| SMILES | C=CC[C@@H]1[C@H]2c3ccccc3CCN2O[C@@]1(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25NO4/c1-5-8-15-16-14-10-7-6-9-13(14)11-12-20(16)24-19(15,22)17(21)23-18(2,3)4/h5-7,9-10,15-16,22H,1,8,11-12H2,2-4H3/t15-,16-,19-/m1/s1 |
| InChIKey | UZLUYRAQOFJERD-GPMSIDNRSA-N |
| XLogP | 2.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|