About (2-bromo-3-pyridinyl) acetate
(2-bromo-3-pyridinyl) acetate (PubChem CID 15471896) has the molecular formula C7H6BrNO2
and a molecular weight of 216.03 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) acetate.
Molecular Properties
| Compound Name | (2-bromo-3-pyridinyl) acetate |
| PubChem CID | 15471896 |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | (2-bromo-3-pyridinyl) acetate |
| SMILES | CC(=O)Oc1cccnc1Br |
| InChI | InChI=1S/C7H6BrNO2/c1-5(10)11-6-3-2-4-9-7(6)8/h2-4H,1H3 |
| InChIKey | KBAUPWCLRRXCFP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3-pyridinyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3-pyridinyl) acetate?
The IUPAC name of (2-bromo-3-pyridinyl) acetate (CID 15471896) is (2-bromo-3-pyridinyl) acetate.
What is the SMILES notation for (2-bromo-3-pyridinyl) acetate?
The canonical SMILES for (2-bromo-3-pyridinyl) acetate is CC(=O)Oc1cccnc1Br.
What is the InChIKey of (2-bromo-3-pyridinyl) acetate?
The InChIKey is KBAUPWCLRRXCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2/c1-5(10)11-6-3-2-4-9-7(6)8/h2-4H,1H3.
What are the key properties of (2-bromo-3-pyridinyl) acetate?
(2-bromo-3-pyridinyl) acetate has a molecular weight of 216.03 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3-pyridinyl) acetate is sourced from PubChem (CID 15471896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).