C14H20S2 — CID 154719049
(3aS)-3a,7-dimethyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] (PubChem CID 154719049) has the molecular formula C14H20S2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (3aS)-3a,7-dimethyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane].
| Compound Name | (3aS)-3a,7-dimethyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 154719049 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (3aS)-3a,7-dimethyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] |
| SMILES | C=C1CCC2=C(C)C3(CC[C@@]12C)SCCS3 |
| InChI | InChI=1S/C14H20S2/c1-10-4-5-12-11(2)14(15-8-9-16-14)7-6-13(10,12)3/h1,4-9H2,2-3H3/t13-/m0/s1 |
| InChIKey | DRJUCCORFRJLKF-ZDUSSCGKSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|