C14H31BO3Si — CID 154719188
trimethyl-[(1S)-3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane (PubChem CID 154719188) has the molecular formula C14H31BO3Si and a molecular weight of 286.30 g/mol. Its IUPAC name is trimethyl-[(1S)-3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane.
| Compound Name | trimethyl-[(1S)-3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane |
|---|---|
| PubChem CID | 154719188 |
| Molecular Formula | C14H31BO3Si |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | trimethyl-[(1S)-3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane |
| SMILES | CC(C)C[C@@H](O[Si](C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H31BO3Si/c1-11(2)10-12(16-19(7,8)9)15-17-13(3,4)14(5,6)18-15/h11-12H,10H2,1-9H3/t12-/m1/s1 |
| InChIKey | OZRNNBGXBKADLI-GFCCVEGCSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|