C19H40O2Si2 — CID 154719316
tert-butyl-dimethyl-[(3E,5Z)-5-triethylsilyloxyhepta-3,5-dienoxy]silane (PubChem CID 154719316) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E,5Z)-5-triethylsilyloxyhepta-3,5-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3E,5Z)-5-triethylsilyloxyhepta-3,5-dienoxy]silane |
|---|---|
| PubChem CID | 154719316 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | tert-butyl-dimethyl-[(3E,5Z)-5-triethylsilyloxyhepta-3,5-dienoxy]silane |
| SMILES | C/C=C(/C=C/CCO[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40O2Si2/c1-10-18(21-23(11-2,12-3)13-4)16-14-15-17-20-22(8,9)19(5,6)7/h10,14,16H,11-13,15,17H2,1-9H3/b16-14+,18-10- |
| InChIKey | DZLVMTWOUGXBPY-NHAFHBFHSA-N |
| XLogP | 6.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|