About 4-phenylmethoxybenzoyl fluoride
4-phenylmethoxybenzoyl fluoride (PubChem CID 154719359) has the molecular formula C14H11FO2
and a molecular weight of 230.24 g/mol. Its IUPAC name is 4-phenylmethoxybenzoyl fluoride.
Molecular Properties
| Compound Name | 4-phenylmethoxybenzoyl fluoride |
| PubChem CID | 154719359 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-phenylmethoxybenzoyl fluoride |
| SMILES | O=C(F)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11FO2/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | IAGQYPMPYZBFBK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylmethoxybenzoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxybenzoyl fluoride?
The IUPAC name of 4-phenylmethoxybenzoyl fluoride (CID 154719359) is 4-phenylmethoxybenzoyl fluoride.
What is the SMILES notation for 4-phenylmethoxybenzoyl fluoride?
The canonical SMILES for 4-phenylmethoxybenzoyl fluoride is O=C(F)c1ccc(OCc2ccccc2)cc1.
What is the InChIKey of 4-phenylmethoxybenzoyl fluoride?
The InChIKey is IAGQYPMPYZBFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO2/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 4-phenylmethoxybenzoyl fluoride?
4-phenylmethoxybenzoyl fluoride has a molecular weight of 230.24 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxybenzoyl fluoride is sourced from PubChem (CID 154719359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).