About butyl 2-hydroxy-3-methylpenta-3,4-dienoate
butyl 2-hydroxy-3-methylpenta-3,4-dienoate (PubChem CID 154719430) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is butyl 2-hydroxy-3-methylpenta-3,4-dienoate.
Molecular Properties
| Compound Name | butyl 2-hydroxy-3-methylpenta-3,4-dienoate |
| PubChem CID | 154719430 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | butyl 2-hydroxy-3-methylpenta-3,4-dienoate |
| SMILES | C=C=C(C)C(O)C(=O)OCCCC |
| InChI | InChI=1S/C10H16O3/c1-4-6-7-13-10(12)9(11)8(3)5-2/h9,11H,2,4,6-7H2,1,3H3 |
| InChIKey | DZMWWHVHVUFUFL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-hydroxy-3-methylpenta-3,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-hydroxy-3-methylpenta-3,4-dienoate?
The IUPAC name of butyl 2-hydroxy-3-methylpenta-3,4-dienoate (CID 154719430) is butyl 2-hydroxy-3-methylpenta-3,4-dienoate.
What is the SMILES notation for butyl 2-hydroxy-3-methylpenta-3,4-dienoate?
The canonical SMILES for butyl 2-hydroxy-3-methylpenta-3,4-dienoate is C=C=C(C)C(O)C(=O)OCCCC.
What is the InChIKey of butyl 2-hydroxy-3-methylpenta-3,4-dienoate?
The InChIKey is DZMWWHVHVUFUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-4-6-7-13-10(12)9(11)8(3)5-2/h9,11H,2,4,6-7H2,1,3H3.
What are the key properties of butyl 2-hydroxy-3-methylpenta-3,4-dienoate?
butyl 2-hydroxy-3-methylpenta-3,4-dienoate has a molecular weight of 184.23 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-hydroxy-3-methylpenta-3,4-dienoate is sourced from PubChem (CID 154719430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).