C21H44B2O5Si — CID 154719528
3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propoxy-tert-butyl-dimethylsilane (PubChem CID 154719528) has the molecular formula C21H44B2O5Si and a molecular weight of 426.29 g/mol. Its IUPAC name is 3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154719528 |
| Molecular Formula | C21H44B2O5Si |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 3,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OB(C(CCO[Si](C)(C)C(C)(C)C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C21H44B2O5Si/c1-17(2,3)29(12,13)24-15-14-16(22-25-18(4,5)19(6,7)26-22)23-27-20(8,9)21(10,11)28-23/h16H,14-15H2,1-13H3 |
| InChIKey | GYVKANUNTAOXKH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|