About (3-diazo-4,4,4-trifluorobutyl)benzene
(3-diazo-4,4,4-trifluorobutyl)benzene (PubChem CID 154719637) has the molecular formula C10H9F3N2
and a molecular weight of 214.19 g/mol. Its IUPAC name is (3-diazo-4,4,4-trifluorobutyl)benzene.
Molecular Properties
| Compound Name | (3-diazo-4,4,4-trifluorobutyl)benzene |
| PubChem CID | 154719637 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (3-diazo-4,4,4-trifluorobutyl)benzene |
| SMILES | [N-]=[N+]=C(CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2/c11-10(12,13)9(15-14)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | BSSIQKHGGYPZLN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3-diazo-4,4,4-trifluorobutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-diazo-4,4,4-trifluorobutyl)benzene?
The IUPAC name of (3-diazo-4,4,4-trifluorobutyl)benzene (CID 154719637) is (3-diazo-4,4,4-trifluorobutyl)benzene.
What is the SMILES notation for (3-diazo-4,4,4-trifluorobutyl)benzene?
The canonical SMILES for (3-diazo-4,4,4-trifluorobutyl)benzene is [N-]=[N+]=C(CCc1ccccc1)C(F)(F)F.
What is the InChIKey of (3-diazo-4,4,4-trifluorobutyl)benzene?
The InChIKey is BSSIQKHGGYPZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2/c11-10(12,13)9(15-14)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of (3-diazo-4,4,4-trifluorobutyl)benzene?
(3-diazo-4,4,4-trifluorobutyl)benzene has a molecular weight of 214.19 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-diazo-4,4,4-trifluorobutyl)benzene is sourced from PubChem (CID 154719637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).