C8H12O3 — CID 154719989
(2R,3S)-2-ethynylhex-5-ene-1,2,3-triol (PubChem CID 154719989) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (2R,3S)-2-ethynylhex-5-ene-1,2,3-triol.
| Compound Name | (2R,3S)-2-ethynylhex-5-ene-1,2,3-triol |
|---|---|
| PubChem CID | 154719989 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (2R,3S)-2-ethynylhex-5-ene-1,2,3-triol |
| SMILES | C#C[C@@](O)(CO)[C@@H](O)CC=C |
| InChI | InChI=1S/C8H12O3/c1-3-5-7(10)8(11,4-2)6-9/h2-3,7,9-11H,1,5-6H2/t7-,8+/m0/s1 |
| InChIKey | AKEJOHAZVXPLGT-JGVFFNPUSA-N |
| XLogP | -0.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|