About 2-amino-6-methoxy-7,9-dihydropurine-8-thione
2-amino-6-methoxy-7,9-dihydropurine-8-thione (PubChem CID 154720136) has the molecular formula C6H7N5OS
and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-amino-6-methoxy-7,9-dihydropurine-8-thione.
Molecular Properties
| Compound Name | 2-amino-6-methoxy-7,9-dihydropurine-8-thione |
| PubChem CID | 154720136 |
| Molecular Formula | C6H7N5OS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-amino-6-methoxy-7,9-dihydropurine-8-thione |
| SMILES | COc1nc(N)nc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C6H7N5OS/c1-12-4-2-3(9-5(7)11-4)10-6(13)8-2/h1H3,(H4,7,8,9,10,11,13) |
| InChIKey | OHESNZBQTXPGCS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-methoxy-7,9-dihydropurine-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-methoxy-7,9-dihydropurine-8-thione?
The IUPAC name of 2-amino-6-methoxy-7,9-dihydropurine-8-thione (CID 154720136) is 2-amino-6-methoxy-7,9-dihydropurine-8-thione.
What is the SMILES notation for 2-amino-6-methoxy-7,9-dihydropurine-8-thione?
The canonical SMILES for 2-amino-6-methoxy-7,9-dihydropurine-8-thione is COc1nc(N)nc2[nH]c(=S)[nH]c12.
What is the InChIKey of 2-amino-6-methoxy-7,9-dihydropurine-8-thione?
The InChIKey is OHESNZBQTXPGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5OS/c1-12-4-2-3(9-5(7)11-4)10-6(13)8-2/h1H3,(H4,7,8,9,10,11,13).
What are the key properties of 2-amino-6-methoxy-7,9-dihydropurine-8-thione?
2-amino-6-methoxy-7,9-dihydropurine-8-thione has a molecular weight of 197.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-methoxy-7,9-dihydropurine-8-thione is sourced from PubChem (CID 154720136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).