C33H52O6Si2 — CID 154720383
(2S,3S,7S,10R,11R)-11,17-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,5-trimethyl-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-1(13),14(18),19-triene-8,12-dione (PubChem CID 154720383) has the molecular formula C33H52O6Si2 and a molecular weight of 600.95 g/mol. Its IUPAC name is (2S,3S,7S,10R,11R)-11,17-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,5-trimethyl-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-1(13),14(18),19-triene-8,12-dione.
| Compound Name | (2S,3S,7S,10R,11R)-11,17-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,5-trimethyl-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-1(13),14(18),19-triene-8,12-dione |
|---|---|
| PubChem CID | 154720383 |
| Molecular Formula | C33H52O6Si2 |
| Molecular Weight | 600.95 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | (2S,3S,7S,10R,11R)-11,17-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,5-trimethyl-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-1(13),14(18),19-triene-8,12-dione |
| SMILES | CC1(C)O[C@@H]2C(=O)C[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)c4c(ccc5c4CCC5O[Si](C)(C)C(C)(C)C)[C@@]3(C)[C@@H]2O1 |
| InChI | InChI=1S/C33H52O6Si2/c1-30(2,3)40(10,11)38-24-17-15-20-19(24)14-16-21-25(20)26(35)27(39-41(12,13)31(4,5)6)22-18-23(34)28-29(33(21,22)9)37-32(7,8)36-28/h14,16,22,24,27-29H,15,17-18H2,1-13H3/t22-,24?,27+,28+,29+,33+/m0/s1 |
| InChIKey | RZFQIDSFSGNOOA-RMHNFUSGSA-N |
| XLogP | 7.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.95 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|