C24H36O7 — CID 154720432
(1R,2S,9S,15R,17S)-9-hydroxy-2,17-bis(methoxymethoxy)-6,11-dimethyl-16-methylidene-8-oxapentacyclo[13.2.1.01,12.03,11.06,10]octadecan-7-one (PubChem CID 154720432) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is (1R,2S,9S,15R,17S)-9-hydroxy-2,17-bis(methoxymethoxy)-6,11-dimethyl-16-methylidene-8-oxapentacyclo[13.2.1.01,12.03,11.06,10]octadecan-7-one.
| Compound Name | (1R,2S,9S,15R,17S)-9-hydroxy-2,17-bis(methoxymethoxy)-6,11-dimethyl-16-methylidene-8-oxapentacyclo[13.2.1.01,12.03,11.06,10]octadecan-7-one |
|---|---|
| PubChem CID | 154720432 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (1R,2S,9S,15R,17S)-9-hydroxy-2,17-bis(methoxymethoxy)-6,11-dimethyl-16-methylidene-8-oxapentacyclo[13.2.1.01,12.03,11.06,10]octadecan-7-one |
| SMILES | C=C1[C@@H]2CCC3C4(C)C(CCC5(C)C(=O)OC(O)C54)[C@H](OCOC)[C@]3(C2)[C@H]1OCOC |
| InChI | InChI=1S/C24H36O7/c1-13-14-6-7-16-23(3)15(8-9-22(2)17(23)20(25)31-21(22)26)19(30-12-28-5)24(16,10-14)18(13)29-11-27-4/h14-20,25H,1,6-12H2,2-5H3/t14-,15?,16?,17?,18+,19+,20?,22?,23?,24+/m1/s1 |
| InChIKey | DJRYIIFSBYQJJP-OSEWALJISA-N |
| XLogP | 2.86 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|