C9H13N5O2S — CID 154720528
(3R,6S,8aS)-6-azido-N-methyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide (PubChem CID 154720528) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is (3R,6S,8aS)-6-azido-N-methyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide.
| Compound Name | (3R,6S,8aS)-6-azido-N-methyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154720528 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (3R,6S,8aS)-6-azido-N-methyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1CS[C@H]2CC[C@H](N=[N+]=[N-])C(=O)N21 |
| InChI | InChI=1S/C9H13N5O2S/c1-11-8(15)6-4-17-7-3-2-5(12-13-10)9(16)14(6)7/h5-7H,2-4H2,1H3,(H,11,15)/t5-,6-,7-/m0/s1 |
| InChIKey | LOBQMBMEOSTNET-ACZMJKKPSA-N |
| XLogP | 0.48 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|