C21H36ClNO4 — CID 154720731
[(1R)-2-[(2S,6R)-6-tert-butyl-4-[(2-chloroacetyl)amino]oxan-2-yl]-1-cyclohexylethyl] acetate (PubChem CID 154720731) has the molecular formula C21H36ClNO4 and a molecular weight of 401.98 g/mol. Its IUPAC name is [(1R)-2-[(2S,6R)-6-tert-butyl-4-[(2-chloroacetyl)amino]oxan-2-yl]-1-cyclohexylethyl] acetate.
| Compound Name | [(1R)-2-[(2S,6R)-6-tert-butyl-4-[(2-chloroacetyl)amino]oxan-2-yl]-1-cyclohexylethyl] acetate |
|---|---|
| PubChem CID | 154720731 |
| Molecular Formula | C21H36ClNO4 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | [(1R)-2-[(2S,6R)-6-tert-butyl-4-[(2-chloroacetyl)amino]oxan-2-yl]-1-cyclohexylethyl] acetate |
| SMILES | CC(=O)O[C@H](C[C@@H]1CC(NC(=O)CCl)C[C@H](C(C)(C)C)O1)C1CCCCC1 |
| InChI | InChI=1S/C21H36ClNO4/c1-14(24)26-18(15-8-6-5-7-9-15)12-17-10-16(23-20(25)13-22)11-19(27-17)21(2,3)4/h15-19H,5-13H2,1-4H3,(H,23,25)/t16?,17-,18+,19+/m0/s1 |
| InChIKey | NKJBKTVNXBJFFB-NRHWTYQISA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|